About disodium;sulfanide;acetate
disodium;sulfanide;acetate (PubChem CID 173135140) has the molecular formula C2H4Na2O2S
and a molecular weight of 138.10 g/mol. Its IUPAC name is disodium;sulfanide;acetate.
Molecular Properties
| Compound Name | disodium;sulfanide;acetate |
| PubChem CID | 173135140 |
| Molecular Formula | C2H4Na2O2S |
| Molecular Weight | 138.10 g/mol |
| Exact Mass | 137.97 |
| IUPAC Name | disodium;sulfanide;acetate |
| SMILES | CC(=O)[O-].[Na+].[Na+].[SH-] |
| InChI | InChI=1S/C2H4O2.2Na.H2S/c1-2(3)4;;;/h1H3,(H,3,4);;;1H2/q;2*+1;/p-2 |
| InChIKey | BBNJFLOQBJECAH-UHFFFAOYSA-L |
| XLogP | -7.51 |
| TPSA | 40.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 138.10 |
| LogP ≤ 5 | -7.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thiol_1', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze disodium;sulfanide;acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of disodium;sulfanide;acetate?
The IUPAC name of disodium;sulfanide;acetate (CID 173135140) is disodium;sulfanide;acetate.
What is the SMILES notation for disodium;sulfanide;acetate?
The canonical SMILES for disodium;sulfanide;acetate is CC(=O)[O-].[Na+].[Na+].[SH-].
What is the InChIKey of disodium;sulfanide;acetate?
The InChIKey is BBNJFLOQBJECAH-UHFFFAOYSA-L. The full InChI is InChI=1S/C2H4O2.2Na.H2S/c1-2(3)4;;;/h1H3,(H,3,4);;;1H2/q;2*+1;/p-2.
What are the key properties of disodium;sulfanide;acetate?
disodium;sulfanide;acetate has a molecular weight of 138.10 g/mol, XLogP of -7.51, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for disodium;sulfanide;acetate is sourced from PubChem (CID 173135140), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).