About trisodium;acetate;carbonate
trisodium;acetate;carbonate (PubChem CID 169079974) has the molecular formula C3H3Na3O5
and a molecular weight of 188.02 g/mol. Its IUPAC name is trisodium;acetate;carbonate.
Molecular Properties
| Compound Name | trisodium;acetate;carbonate |
| PubChem CID | 169079974 |
| Molecular Formula | C3H3Na3O5 |
| Molecular Weight | 188.02 g/mol |
| Exact Mass | 187.97 |
| IUPAC Name | trisodium;acetate;carbonate |
| SMILES | CC(=O)[O-].O=C([O-])[O-].[Na+].[Na+].[Na+] |
| InChI | InChI=1S/C2H4O2.CH2O3.3Na/c1-2(3)4;2-1(3)4;;;/h1H3,(H,3,4);(H2,2,3,4);;;/q;;3*+1/p-3 |
| InChIKey | NISZEBCNNYKSQN-UHFFFAOYSA-K |
| XLogP | -12.68 |
| TPSA | 103.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 188.02 |
| LogP ≤ 5 | -12.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze trisodium;acetate;carbonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of trisodium;acetate;carbonate?
The IUPAC name of trisodium;acetate;carbonate (CID 169079974) is trisodium;acetate;carbonate.
What is the SMILES notation for trisodium;acetate;carbonate?
The canonical SMILES for trisodium;acetate;carbonate is CC(=O)[O-].O=C([O-])[O-].[Na+].[Na+].[Na+].
What is the InChIKey of trisodium;acetate;carbonate?
The InChIKey is NISZEBCNNYKSQN-UHFFFAOYSA-K. The full InChI is InChI=1S/C2H4O2.CH2O3.3Na/c1-2(3)4;2-1(3)4;;;/h1H3,(H,3,4);(H2,2,3,4);;;/q;;3*+1/p-3.
What are the key properties of trisodium;acetate;carbonate?
trisodium;acetate;carbonate has a molecular weight of 188.02 g/mol, XLogP of -12.68, 0 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for trisodium;acetate;carbonate is sourced from PubChem (CID 169079974), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).