About bis(manganese(2+));acetate;carbonate
bis(manganese(2+));acetate;carbonate (PubChem CID 158739591) has the molecular formula C3H3Mn2O5+
and a molecular weight of 228.93 g/mol. Its IUPAC name is bis(manganese(2+));acetate;carbonate.
Molecular Properties
| Compound Name | bis(manganese(2+));acetate;carbonate |
| PubChem CID | 158739591 |
| Molecular Formula | C3H3Mn2O5+ |
| Molecular Weight | 228.93 g/mol |
| Exact Mass | 228.87 |
| IUPAC Name | bis(manganese(2+));acetate;carbonate |
| SMILES | CC(=O)[O-].O=C([O-])[O-].[Mn+2].[Mn+2] |
| InChI | InChI=1S/C2H4O2.CH2O3.2Mn/c1-2(3)4;2-1(3)4;;/h1H3,(H,3,4);(H2,2,3,4);;/q;;2*+2/p-3 |
| InChIKey | BCRZOPUMJMNHRG-UHFFFAOYSA-K |
| XLogP | -3.70 |
| TPSA | 103.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 228.93 |
| LogP ≤ 5 | -3.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze bis(manganese(2+));acetate;carbonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis(manganese(2+));acetate;carbonate?
The IUPAC name of bis(manganese(2+));acetate;carbonate (CID 158739591) is bis(manganese(2+));acetate;carbonate.
What is the SMILES notation for bis(manganese(2+));acetate;carbonate?
The canonical SMILES for bis(manganese(2+));acetate;carbonate is CC(=O)[O-].O=C([O-])[O-].[Mn+2].[Mn+2].
What is the InChIKey of bis(manganese(2+));acetate;carbonate?
The InChIKey is BCRZOPUMJMNHRG-UHFFFAOYSA-K. The full InChI is InChI=1S/C2H4O2.CH2O3.2Mn/c1-2(3)4;2-1(3)4;;/h1H3,(H,3,4);(H2,2,3,4);;/q;;2*+2/p-3.
What are the key properties of bis(manganese(2+));acetate;carbonate?
bis(manganese(2+));acetate;carbonate has a molecular weight of 228.93 g/mol, XLogP of -3.70, 0 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for bis(manganese(2+));acetate;carbonate is sourced from PubChem (CID 158739591), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).