About manganese(2+);acetate;hydroxide
manganese(2+);acetate;hydroxide (PubChem CID 56943305) has the molecular formula C2H4MnO3
and a molecular weight of 130.99 g/mol. Its IUPAC name is manganese(2+);acetate;hydroxide.
Molecular Properties
| Compound Name | manganese(2+);acetate;hydroxide |
| PubChem CID | 56943305 |
| Molecular Formula | C2H4MnO3 |
| Molecular Weight | 130.99 g/mol |
| Exact Mass | 130.95 |
| IUPAC Name | manganese(2+);acetate;hydroxide |
| SMILES | CC(=O)[O-].[Mn+2].[OH-] |
| InChI | InChI=1S/C2H4O2.Mn.H2O/c1-2(3)4;;/h1H3,(H,3,4);;1H2/q;+2;/p-2 |
| InChIKey | XMWPRZVBMXSMCP-UHFFFAOYSA-L |
| XLogP | -1.42 |
| TPSA | 70.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 6 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 130.99 |
| LogP ≤ 5 | -1.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze manganese(2+);acetate;hydroxide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of manganese(2+);acetate;hydroxide?
The IUPAC name of manganese(2+);acetate;hydroxide (CID 56943305) is manganese(2+);acetate;hydroxide.
What is the SMILES notation for manganese(2+);acetate;hydroxide?
The canonical SMILES for manganese(2+);acetate;hydroxide is CC(=O)[O-].[Mn+2].[OH-].
What is the InChIKey of manganese(2+);acetate;hydroxide?
The InChIKey is XMWPRZVBMXSMCP-UHFFFAOYSA-L. The full InChI is InChI=1S/C2H4O2.Mn.H2O/c1-2(3)4;;/h1H3,(H,3,4);;1H2/q;+2;/p-2.
What are the key properties of manganese(2+);acetate;hydroxide?
manganese(2+);acetate;hydroxide has a molecular weight of 130.99 g/mol, XLogP of -1.42, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for manganese(2+);acetate;hydroxide is sourced from PubChem (CID 56943305), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).