About bis(zirconium(4+));acetate;hydroxide
bis(zirconium(4+));acetate;hydroxide (PubChem CID 172795489) has the molecular formula C2H4O3Zr2+6
and a molecular weight of 258.50 g/mol. Its IUPAC name is bis(zirconium(4+));acetate;hydroxide.
Molecular Properties
| Compound Name | bis(zirconium(4+));acetate;hydroxide |
| PubChem CID | 172795489 |
| Molecular Formula | C2H4O3Zr2+6 |
| Molecular Weight | 258.50 g/mol |
| Exact Mass | 255.82 |
| IUPAC Name | bis(zirconium(4+));acetate;hydroxide |
| SMILES | CC(=O)[O-].[OH-].[Zr+4].[Zr+4] |
| InChI | InChI=1S/C2H4O2.H2O.2Zr/c1-2(3)4;;;/h1H3,(H,3,4);1H2;;/q;;2*+4/p-2 |
| InChIKey | QDLCWBOFMJOMPR-UHFFFAOYSA-L |
| XLogP | -1.43 |
| TPSA | 70.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 258.50 |
| LogP ≤ 5 | -1.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze bis(zirconium(4+));acetate;hydroxide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis(zirconium(4+));acetate;hydroxide?
The IUPAC name of bis(zirconium(4+));acetate;hydroxide (CID 172795489) is bis(zirconium(4+));acetate;hydroxide.
What is the SMILES notation for bis(zirconium(4+));acetate;hydroxide?
The canonical SMILES for bis(zirconium(4+));acetate;hydroxide is CC(=O)[O-].[OH-].[Zr+4].[Zr+4].
What is the InChIKey of bis(zirconium(4+));acetate;hydroxide?
The InChIKey is QDLCWBOFMJOMPR-UHFFFAOYSA-L. The full InChI is InChI=1S/C2H4O2.H2O.2Zr/c1-2(3)4;;;/h1H3,(H,3,4);1H2;;/q;;2*+4/p-2.
What are the key properties of bis(zirconium(4+));acetate;hydroxide?
bis(zirconium(4+));acetate;hydroxide has a molecular weight of 258.50 g/mol, XLogP of -1.43, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for bis(zirconium(4+));acetate;hydroxide is sourced from PubChem (CID 172795489), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).