About azanide;platinum(2+);acetate
azanide;platinum(2+);acetate (PubChem CID 11988358) has the molecular formula C2H5NO2Pt
and a molecular weight of 270.14 g/mol. Its IUPAC name is azanide;platinum(2+);acetate.
Molecular Properties
| Compound Name | azanide;platinum(2+);acetate |
| PubChem CID | 11988358 |
| Molecular Formula | C2H5NO2Pt |
| Molecular Weight | 270.14 g/mol |
| Exact Mass | 270.00 |
| IUPAC Name | azanide;platinum(2+);acetate |
| SMILES | CC(=O)[O-].[NH2-].[Pt+2] |
| InChI | InChI=1S/C2H4O2.H2N.Pt/c1-2(3)4;;/h1H3,(H,3,4);1H2;/q;-1;+2/p-1 |
| InChIKey | QWKWRCNONPZXOX-UHFFFAOYSA-M |
| XLogP | -0.53 |
| TPSA | 73.63 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 6 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 270.14 |
| LogP ≤ 5 | -0.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze azanide;platinum(2+);acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of azanide;platinum(2+);acetate?
The IUPAC name of azanide;platinum(2+);acetate (CID 11988358) is azanide;platinum(2+);acetate.
What is the SMILES notation for azanide;platinum(2+);acetate?
The canonical SMILES for azanide;platinum(2+);acetate is CC(=O)[O-].[NH2-].[Pt+2].
What is the InChIKey of azanide;platinum(2+);acetate?
The InChIKey is QWKWRCNONPZXOX-UHFFFAOYSA-M. The full InChI is InChI=1S/C2H4O2.H2N.Pt/c1-2(3)4;;/h1H3,(H,3,4);1H2;/q;-1;+2/p-1.
What are the key properties of azanide;platinum(2+);acetate?
azanide;platinum(2+);acetate has a molecular weight of 270.14 g/mol, XLogP of -0.53, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for azanide;platinum(2+);acetate is sourced from PubChem (CID 11988358), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).