About silver;ethanol;acetate
silver;ethanol;acetate (PubChem CID 162162273) has the molecular formula C4H9AgO3
and a molecular weight of 212.98 g/mol. Its IUPAC name is silver;ethanol;acetate.
Molecular Properties
| Compound Name | silver;ethanol;acetate |
| PubChem CID | 162162273 |
| Molecular Formula | C4H9AgO3 |
| Molecular Weight | 212.98 g/mol |
| Exact Mass | 211.96 |
| IUPAC Name | silver;ethanol;acetate |
| SMILES | CC(=O)[O-].CCO.[Ag+] |
| InChI | InChI=1S/C2H4O2.C2H6O.Ag/c1-2(3)4;1-2-3;/h1H3,(H,3,4);3H,2H2,1H3;/q;;+1/p-1 |
| InChIKey | ZMQKZSQODJUBTO-UHFFFAOYSA-M |
| XLogP | -1.25 |
| TPSA | 60.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 212.98 |
| LogP ≤ 5 | -1.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze silver;ethanol;acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of silver;ethanol;acetate?
The IUPAC name of silver;ethanol;acetate (CID 162162273) is silver;ethanol;acetate.
What is the SMILES notation for silver;ethanol;acetate?
The canonical SMILES for silver;ethanol;acetate is CC(=O)[O-].CCO.[Ag+].
What is the InChIKey of silver;ethanol;acetate?
The InChIKey is ZMQKZSQODJUBTO-UHFFFAOYSA-M. The full InChI is InChI=1S/C2H4O2.C2H6O.Ag/c1-2(3)4;1-2-3;/h1H3,(H,3,4);3H,2H2,1H3;/q;;+1/p-1.
What are the key properties of silver;ethanol;acetate?
silver;ethanol;acetate has a molecular weight of 212.98 g/mol, XLogP of -1.25, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for silver;ethanol;acetate is sourced from PubChem (CID 162162273), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).