About disodium;butanedioate;ethanol
disodium;butanedioate;ethanol (PubChem CID 86659235) has the molecular formula C6H10Na2O5
and a molecular weight of 208.12 g/mol. Its IUPAC name is disodium;butanedioate;ethanol.
Molecular Properties
| Compound Name | disodium;butanedioate;ethanol |
| PubChem CID | 86659235 |
| Molecular Formula | C6H10Na2O5 |
| Molecular Weight | 208.12 g/mol |
| Exact Mass | 208.03 |
| IUPAC Name | disodium;butanedioate;ethanol |
| SMILES | CCO.O=C([O-])CCC(=O)[O-].[Na+].[Na+] |
| InChI | InChI=1S/C4H6O4.C2H6O.2Na/c5-3(6)1-2-4(7)8;1-2-3;;/h1-2H2,(H,5,6)(H,7,8);3H,2H2,1H3;;/q;;2*+1/p-2 |
| InChIKey | UVSSTDUXAJJXGS-UHFFFAOYSA-L |
| XLogP | -8.73 |
| TPSA | 100.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 208.12 |
| LogP ≤ 5 | -8.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze disodium;butanedioate;ethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of disodium;butanedioate;ethanol?
The IUPAC name of disodium;butanedioate;ethanol (CID 86659235) is disodium;butanedioate;ethanol.
What is the SMILES notation for disodium;butanedioate;ethanol?
The canonical SMILES for disodium;butanedioate;ethanol is CCO.O=C([O-])CCC(=O)[O-].[Na+].[Na+].
What is the InChIKey of disodium;butanedioate;ethanol?
The InChIKey is UVSSTDUXAJJXGS-UHFFFAOYSA-L. The full InChI is InChI=1S/C4H6O4.C2H6O.2Na/c5-3(6)1-2-4(7)8;1-2-3;;/h1-2H2,(H,5,6)(H,7,8);3H,2H2,1H3;;/q;;2*+1/p-2.
What are the key properties of disodium;butanedioate;ethanol?
disodium;butanedioate;ethanol has a molecular weight of 208.12 g/mol, XLogP of -8.73, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for disodium;butanedioate;ethanol is sourced from PubChem (CID 86659235), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).