About azanium;lithium;butanedioate
azanium;lithium;butanedioate (PubChem CID 18352245) has the molecular formula C4H8LiNO4
and a molecular weight of 141.05 g/mol. Its IUPAC name is azanium;lithium;butanedioate.
Molecular Properties
| Compound Name | azanium;lithium;butanedioate |
| PubChem CID | 18352245 |
| Molecular Formula | C4H8LiNO4 |
| Molecular Weight | 141.05 g/mol |
| Exact Mass | 141.06 |
| IUPAC Name | azanium;lithium;butanedioate |
| SMILES | O=C([O-])CCC(=O)[O-].[Li+].[NH4+] |
| InChI | InChI=1S/C4H6O4.Li.H3N/c5-3(6)1-2-4(7)8;;/h1-2H2,(H,5,6)(H,7,8);;1H3/q;+1;/p-1 |
| InChIKey | AVOXSDYQTLQGIB-UHFFFAOYSA-M |
| XLogP | -5.35 |
| TPSA | 116.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 141.05 |
| LogP ≤ 5 | -5.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze azanium;lithium;butanedioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of azanium;lithium;butanedioate?
The IUPAC name of azanium;lithium;butanedioate (CID 18352245) is azanium;lithium;butanedioate.
What is the SMILES notation for azanium;lithium;butanedioate?
The canonical SMILES for azanium;lithium;butanedioate is O=C([O-])CCC(=O)[O-].[Li+].[NH4+].
What is the InChIKey of azanium;lithium;butanedioate?
The InChIKey is AVOXSDYQTLQGIB-UHFFFAOYSA-M. The full InChI is InChI=1S/C4H6O4.Li.H3N/c5-3(6)1-2-4(7)8;;/h1-2H2,(H,5,6)(H,7,8);;1H3/q;+1;/p-1.
What are the key properties of azanium;lithium;butanedioate?
azanium;lithium;butanedioate has a molecular weight of 141.05 g/mol, XLogP of -5.35, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for azanium;lithium;butanedioate is sourced from PubChem (CID 18352245), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).