About azanium 3-aminopropanoate
azanium 3-aminopropanoate (PubChem CID 156782733) has the molecular formula C3H10N2O2
and a molecular weight of 106.12 g/mol. Its IUPAC name is azanium 3-aminopropanoate.
Molecular Properties
| Compound Name | azanium 3-aminopropanoate |
| PubChem CID | 156782733 |
| Molecular Formula | C3H10N2O2 |
| Molecular Weight | 106.12 g/mol |
| Exact Mass | 106.07 |
| IUPAC Name | azanium 3-aminopropanoate |
| SMILES | NCCC(=O)[O-].[NH4+] |
| InChI | InChI=1S/C3H7NO2.H3N/c4-2-1-3(5)6;/h1-2,4H2,(H,5,6);1H3 |
| InChIKey | GPYAZGPPTOWQAH-UHFFFAOYSA-N |
| XLogP | -1.54 |
| TPSA | 102.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 106.12 |
| LogP ≤ 5 | -1.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze azanium 3-aminopropanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of azanium 3-aminopropanoate?
The IUPAC name of azanium 3-aminopropanoate (CID 156782733) is azanium 3-aminopropanoate.
What is the SMILES notation for azanium 3-aminopropanoate?
The canonical SMILES for azanium 3-aminopropanoate is NCCC(=O)[O-].[NH4+].
What is the InChIKey of azanium 3-aminopropanoate?
The InChIKey is GPYAZGPPTOWQAH-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H7NO2.H3N/c4-2-1-3(5)6;/h1-2,4H2,(H,5,6);1H3.
What are the key properties of azanium 3-aminopropanoate?
azanium 3-aminopropanoate has a molecular weight of 106.12 g/mol, XLogP of -1.54, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for azanium 3-aminopropanoate is sourced from PubChem (CID 156782733), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).