About iodanium 5-aminopentanoate
iodanium 5-aminopentanoate (PubChem CID 162316795) has the molecular formula C5H12INO2
and a molecular weight of 245.06 g/mol. Its IUPAC name is iodanium 5-aminopentanoate.
Molecular Properties
| Compound Name | iodanium 5-aminopentanoate |
| PubChem CID | 162316795 |
| Molecular Formula | C5H12INO2 |
| Molecular Weight | 245.06 g/mol |
| Exact Mass | 244.99 |
| IUPAC Name | iodanium 5-aminopentanoate |
| SMILES | NCCCCC(=O)[O-].[IH2+] |
| InChI | InChI=1S/C5H11NO2.H2I/c6-4-2-1-3-5(7)8;/h1-4,6H2,(H,7,8);1H2/q;+1/p-1 |
| InChIKey | DLSJGNDLKRLBIG-UHFFFAOYSA-M |
| XLogP | -4.67 |
| TPSA | 66.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 245.06 |
| LogP ≤ 5 | -4.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze iodanium 5-aminopentanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of iodanium 5-aminopentanoate?
The IUPAC name of iodanium 5-aminopentanoate (CID 162316795) is iodanium 5-aminopentanoate.
What is the SMILES notation for iodanium 5-aminopentanoate?
The canonical SMILES for iodanium 5-aminopentanoate is NCCCCC(=O)[O-].[IH2+].
What is the InChIKey of iodanium 5-aminopentanoate?
The InChIKey is DLSJGNDLKRLBIG-UHFFFAOYSA-M. The full InChI is InChI=1S/C5H11NO2.H2I/c6-4-2-1-3-5(7)8;/h1-4,6H2,(H,7,8);1H2/q;+1/p-1.
What are the key properties of iodanium 5-aminopentanoate?
iodanium 5-aminopentanoate has a molecular weight of 245.06 g/mol, XLogP of -4.67, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for iodanium 5-aminopentanoate is sourced from PubChem (CID 162316795), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).