About octan-1-amine;octanoate
octan-1-amine;octanoate (PubChem CID 23330056) has the molecular formula C16H34NO2-
and a molecular weight of 272.45 g/mol. Its IUPAC name is octan-1-amine;octanoate.
Molecular Properties
| Compound Name | octan-1-amine;octanoate |
| PubChem CID | 23330056 |
| Molecular Formula | C16H34NO2- |
| Molecular Weight | 272.45 g/mol |
| Exact Mass | 272.26 |
| IUPAC Name | octan-1-amine;octanoate |
| SMILES | CCCCCCCC(=O)[O-].CCCCCCCCN |
| InChI | InChI=1S/C8H19N.C8H16O2/c1-2-3-4-5-6-7-8-9;1-2-3-4-5-6-7-8(9)10/h2-9H2,1H3;2-7H2,1H3,(H,9,10)/p-1 |
| InChIKey | LQNPIBHEOATAEO-UHFFFAOYSA-M |
| XLogP | 3.40 |
| TPSA | 66.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 272.45 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze octan-1-amine;octanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of octan-1-amine;octanoate?
The IUPAC name of octan-1-amine;octanoate (CID 23330056) is octan-1-amine;octanoate.
What is the SMILES notation for octan-1-amine;octanoate?
The canonical SMILES for octan-1-amine;octanoate is CCCCCCCC(=O)[O-].CCCCCCCCN.
What is the InChIKey of octan-1-amine;octanoate?
The InChIKey is LQNPIBHEOATAEO-UHFFFAOYSA-M. The full InChI is InChI=1S/C8H19N.C8H16O2/c1-2-3-4-5-6-7-8-9;1-2-3-4-5-6-7-8(9)10/h2-9H2,1H3;2-7H2,1H3,(H,9,10)/p-1.
What are the key properties of octan-1-amine;octanoate?
octan-1-amine;octanoate has a molecular weight of 272.45 g/mol, XLogP of 3.40, 12 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for octan-1-amine;octanoate is sourced from PubChem (CID 23330056), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).