About calcium bis(3-aminopropanoate)
calcium bis(3-aminopropanoate) (PubChem CID 135001381) has the molecular formula C6H12CaN2O4
and a molecular weight of 216.25 g/mol. Its IUPAC name is calcium bis(3-aminopropanoate).
Molecular Properties
| Compound Name | calcium bis(3-aminopropanoate) |
| PubChem CID | 135001381 |
| Molecular Formula | C6H12CaN2O4 |
| Molecular Weight | 216.25 g/mol |
| Exact Mass | 216.04 |
| IUPAC Name | calcium bis(3-aminopropanoate) |
| SMILES | NCCC(=O)[O-].NCCC(=O)[O-].[Ca+2] |
| InChI | InChI=1S/2C3H7NO2.Ca/c2*4-2-1-3(5)6;/h2*1-2,4H2,(H,5,6);/q;;+2/p-2 |
| InChIKey | QRTVQUYKMVAQBJ-UHFFFAOYSA-L |
| XLogP | -4.21 |
| TPSA | 132.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 216.25 |
| LogP ≤ 5 | -4.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze calcium bis(3-aminopropanoate) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of calcium bis(3-aminopropanoate)?
The IUPAC name of calcium bis(3-aminopropanoate) (CID 135001381) is calcium bis(3-aminopropanoate).
What is the SMILES notation for calcium bis(3-aminopropanoate)?
The canonical SMILES for calcium bis(3-aminopropanoate) is NCCC(=O)[O-].NCCC(=O)[O-].[Ca+2].
What is the InChIKey of calcium bis(3-aminopropanoate)?
The InChIKey is QRTVQUYKMVAQBJ-UHFFFAOYSA-L. The full InChI is InChI=1S/2C3H7NO2.Ca/c2*4-2-1-3(5)6;/h2*1-2,4H2,(H,5,6);/q;;+2/p-2.
What are the key properties of calcium bis(3-aminopropanoate)?
calcium bis(3-aminopropanoate) has a molecular weight of 216.25 g/mol, XLogP of -4.21, 4 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for calcium bis(3-aminopropanoate) is sourced from PubChem (CID 135001381), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).