About zinc bis(3-aminopropanoate)
zinc bis(3-aminopropanoate) (PubChem CID 87686720) has the molecular formula C6H12N2O4Zn
and a molecular weight of 241.56 g/mol. Its IUPAC name is zinc bis(3-aminopropanoate).
Molecular Properties
| Compound Name | zinc bis(3-aminopropanoate) |
| PubChem CID | 87686720 |
| Molecular Formula | C6H12N2O4Zn |
| Molecular Weight | 241.56 g/mol |
| Exact Mass | 240.01 |
| IUPAC Name | zinc bis(3-aminopropanoate) |
| SMILES | NCCC(=O)[O-].NCCC(=O)[O-].[Zn+2] |
| InChI | InChI=1S/2C3H7NO2.Zn/c2*4-2-1-3(5)6;/h2*1-2,4H2,(H,5,6);/q;;+2/p-2 |
| InChIKey | IHIVNHJCSWRGLZ-UHFFFAOYSA-L |
| XLogP | -3.83 |
| TPSA | 132.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 241.56 |
| LogP ≤ 5 | -3.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze zinc bis(3-aminopropanoate) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of zinc bis(3-aminopropanoate)?
The IUPAC name of zinc bis(3-aminopropanoate) (CID 87686720) is zinc bis(3-aminopropanoate).
What is the SMILES notation for zinc bis(3-aminopropanoate)?
The canonical SMILES for zinc bis(3-aminopropanoate) is NCCC(=O)[O-].NCCC(=O)[O-].[Zn+2].
What is the InChIKey of zinc bis(3-aminopropanoate)?
The InChIKey is IHIVNHJCSWRGLZ-UHFFFAOYSA-L. The full InChI is InChI=1S/2C3H7NO2.Zn/c2*4-2-1-3(5)6;/h2*1-2,4H2,(H,5,6);/q;;+2/p-2.
What are the key properties of zinc bis(3-aminopropanoate)?
zinc bis(3-aminopropanoate) has a molecular weight of 241.56 g/mol, XLogP of -3.83, 4 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for zinc bis(3-aminopropanoate) is sourced from PubChem (CID 87686720), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).