C3H8N2O3Zn — CID 88673860
zinc;ethane-1,2-diamine;carbonate (PubChem CID 88673860) has the molecular formula C3H8N2O3Zn and a molecular weight of 185.50 g/mol. Its IUPAC name is zinc;ethane-1,2-diamine;carbonate.
| Compound Name | zinc;ethane-1,2-diamine;carbonate |
|---|---|
| PubChem CID | 88673860 |
| Molecular Formula | C3H8N2O3Zn |
| Molecular Weight | 185.50 g/mol |
| Exact Mass | 183.98 |
| IUPAC Name | zinc;ethane-1,2-diamine;carbonate |
| SMILES | NCCN.O=C([O-])[O-].[Zn+2] |
| InChI | InChI=1S/C2H8N2.CH2O3.Zn/c3-1-2-4;2-1(3)4;/h1-4H2;(H2,2,3,4);/q;;+2/p-2 |
| InChIKey | QZAPQGJVKCYCPE-UHFFFAOYSA-L |
| XLogP | -3.55 |
| TPSA | 115.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 185.50 |
| LogP ≤ 5 | -3.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|