C4H8N2O4Pt — CID 3038580
ethane-1,2-diamine;oxalate;platinum(2+) (PubChem CID 3038580) has the molecular formula C4H8N2O4Pt and a molecular weight of 343.20 g/mol. Its IUPAC name is ethane-1,2-diamine;oxalate;platinum(2+).
| Compound Name | ethane-1,2-diamine;oxalate;platinum(2+) |
|---|---|
| PubChem CID | 3038580 |
| Molecular Formula | C4H8N2O4Pt |
| Molecular Weight | 343.20 g/mol |
| Exact Mass | 343.01 |
| IUPAC Name | ethane-1,2-diamine;oxalate;platinum(2+) |
| SMILES | NCCN.O=C([O-])C(=O)[O-].[Pt+2] |
| InChI | InChI=1S/C2H8N2.C2H2O4.Pt/c3-1-2-4;3-1(4)2(5)6;/h1-4H2;(H,3,4)(H,5,6);/q;;+2/p-2 |
| InChIKey | ZKRRKWHVIXOAJT-UHFFFAOYSA-L |
| XLogP | -4.61 |
| TPSA | 132.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.20 |
| LogP ≤ 5 | -4.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|