About hydron;propanedioate
hydron;propanedioate (PubChem CID 23511544) has the molecular formula C3H4O4
and a molecular weight of 104.06 g/mol. Its IUPAC name is hydron;propanedioate.
Molecular Properties
| Compound Name | hydron;propanedioate |
| PubChem CID | 23511544 |
| Molecular Formula | C3H4O4 |
| Molecular Weight | 104.06 g/mol |
| Exact Mass | 104.01 |
| IUPAC Name | hydron;propanedioate |
| SMILES | O=C([O-])CC(=O)[O-].[H+].[H+] |
| InChI | InChI=1S/C3H4O4/c4-2(5)1-3(6)7/h1H2,(H,4,5)(H,6,7) |
| InChIKey | OFOBLEOULBTSOW-UHFFFAOYSA-N |
| XLogP | -2.90 |
| TPSA | 80.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 104.06 |
| LogP ≤ 5 | -2.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze hydron;propanedioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of hydron;propanedioate?
The IUPAC name of hydron;propanedioate (CID 23511544) is hydron;propanedioate.
What is the SMILES notation for hydron;propanedioate?
The canonical SMILES for hydron;propanedioate is O=C([O-])CC(=O)[O-].[H+].[H+].
What is the InChIKey of hydron;propanedioate?
The InChIKey is OFOBLEOULBTSOW-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H4O4/c4-2(5)1-3(6)7/h1H2,(H,4,5)(H,6,7).
What are the key properties of hydron;propanedioate?
hydron;propanedioate has a molecular weight of 104.06 g/mol, XLogP of -2.90, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for hydron;propanedioate is sourced from PubChem (CID 23511544), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).