About 4-chlorobutanoate chloride
4-chlorobutanoate chloride (PubChem CID 22118176) has the molecular formula C4H6Cl2O2-2
and a molecular weight of 157.00 g/mol. Its IUPAC name is 4-chlorobutanoate chloride.
Molecular Properties
| Compound Name | 4-chlorobutanoate chloride |
| PubChem CID | 22118176 |
| Molecular Formula | C4H6Cl2O2-2 |
| Molecular Weight | 157.00 g/mol |
| Exact Mass | 155.98 |
| IUPAC Name | 4-chlorobutanoate chloride |
| SMILES | O=C([O-])CCCCl.[Cl-] |
| InChI | InChI=1S/C4H7ClO2.ClH/c5-3-1-2-4(6)7;/h1-3H2,(H,6,7);1H/p-2 |
| InChIKey | SZXUSRXTRIRKQO-UHFFFAOYSA-L |
| XLogP | -3.24 |
| TPSA | 40.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 157.00 |
| LogP ≤ 5 | -3.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 4-chlorobutanoate chloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-chlorobutanoate chloride?
The IUPAC name of 4-chlorobutanoate chloride (CID 22118176) is 4-chlorobutanoate chloride.
What is the SMILES notation for 4-chlorobutanoate chloride?
The canonical SMILES for 4-chlorobutanoate chloride is O=C([O-])CCCCl.[Cl-].
What is the InChIKey of 4-chlorobutanoate chloride?
The InChIKey is SZXUSRXTRIRKQO-UHFFFAOYSA-L. The full InChI is InChI=1S/C4H7ClO2.ClH/c5-3-1-2-4(6)7;/h1-3H2,(H,6,7);1H/p-2.
What are the key properties of 4-chlorobutanoate chloride?
4-chlorobutanoate chloride has a molecular weight of 157.00 g/mol, XLogP of -3.24, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-chlorobutanoate chloride is sourced from PubChem (CID 22118176), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).