About zinc bis(4-chlorobutanoate)
zinc bis(4-chlorobutanoate) (PubChem CID 88622663) has the molecular formula C8H12Cl2O4Zn
and a molecular weight of 308.48 g/mol. Its IUPAC name is zinc bis(4-chlorobutanoate).
Molecular Properties
| Compound Name | zinc bis(4-chlorobutanoate) |
| PubChem CID | 88622663 |
| Molecular Formula | C8H12Cl2O4Zn |
| Molecular Weight | 308.48 g/mol |
| Exact Mass | 305.94 |
| IUPAC Name | zinc bis(4-chlorobutanoate) |
| SMILES | O=C([O-])CCCCl.O=C([O-])CCCCl.[Zn+2] |
| InChI | InChI=1S/2C4H7ClO2.Zn/c2*5-3-1-2-4(6)7;/h2*1-3H2,(H,6,7);/q;;+2/p-2 |
| InChIKey | RCHBUBBYWNKSQM-UHFFFAOYSA-L |
| XLogP | -0.49 |
| TPSA | 80.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 308.48 |
| LogP ≤ 5 | -0.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze zinc bis(4-chlorobutanoate) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of zinc bis(4-chlorobutanoate)?
The IUPAC name of zinc bis(4-chlorobutanoate) (CID 88622663) is zinc bis(4-chlorobutanoate).
What is the SMILES notation for zinc bis(4-chlorobutanoate)?
The canonical SMILES for zinc bis(4-chlorobutanoate) is O=C([O-])CCCCl.O=C([O-])CCCCl.[Zn+2].
What is the InChIKey of zinc bis(4-chlorobutanoate)?
The InChIKey is RCHBUBBYWNKSQM-UHFFFAOYSA-L. The full InChI is InChI=1S/2C4H7ClO2.Zn/c2*5-3-1-2-4(6)7;/h2*1-3H2,(H,6,7);/q;;+2/p-2.
What are the key properties of zinc bis(4-chlorobutanoate)?
zinc bis(4-chlorobutanoate) has a molecular weight of 308.48 g/mol, XLogP of -0.49, 6 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for zinc bis(4-chlorobutanoate) is sourced from PubChem (CID 88622663), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).