About 2-chloroacetate;triphenylstannanylium
2-chloroacetate;triphenylstannanylium (PubChem CID 10225423) has the molecular formula C20H17ClO2Sn
and a molecular weight of 443.52 g/mol. Its IUPAC name is 2-chloroacetate;triphenylstannanylium.
Molecular Properties
| Compound Name | 2-chloroacetate;triphenylstannanylium |
| PubChem CID | 10225423 |
| Molecular Formula | C20H17ClO2Sn |
| Molecular Weight | 443.52 g/mol |
| Exact Mass | 443.99 |
| IUPAC Name | 2-chloroacetate;triphenylstannanylium |
| SMILES | O=C([O-])CCl.c1ccc([Sn+](c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/3C6H5.C2H3ClO2.Sn/c3*1-2-4-6-5-3-1;3-1-2(4)5;/h3*1-5H;1H2,(H,4,5);/q;;;;+1/p-1 |
| InChIKey | XOFYGTPELGZPLY-UHFFFAOYSA-M |
| XLogP | 1.18 |
| TPSA | 40.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 443.52 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 2-chloroacetate;triphenylstannanylium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-chloroacetate;triphenylstannanylium?
The IUPAC name of 2-chloroacetate;triphenylstannanylium (CID 10225423) is 2-chloroacetate;triphenylstannanylium.
What is the SMILES notation for 2-chloroacetate;triphenylstannanylium?
The canonical SMILES for 2-chloroacetate;triphenylstannanylium is O=C([O-])CCl.c1ccc([Sn+](c2ccccc2)c2ccccc2)cc1.
What is the InChIKey of 2-chloroacetate;triphenylstannanylium?
The InChIKey is XOFYGTPELGZPLY-UHFFFAOYSA-M. The full InChI is InChI=1S/3C6H5.C2H3ClO2.Sn/c3*1-2-4-6-5-3-1;3-1-2(4)5;/h3*1-5H;1H2,(H,4,5);/q;;;;+1/p-1.
What are the key properties of 2-chloroacetate;triphenylstannanylium?
2-chloroacetate;triphenylstannanylium has a molecular weight of 443.52 g/mol, XLogP of 1.18, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-chloroacetate;triphenylstannanylium is sourced from PubChem (CID 10225423), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).