About 2-chloroacetic acid;triphenylphosphane
2-chloroacetic acid;triphenylphosphane (PubChem CID 158594327) has the molecular formula C20H18ClO2P
and a molecular weight of 356.79 g/mol. Its IUPAC name is 2-chloroacetic acid;triphenylphosphane.
Molecular Properties
| Compound Name | 2-chloroacetic acid;triphenylphosphane |
| PubChem CID | 158594327 |
| Molecular Formula | C20H18ClO2P |
| Molecular Weight | 356.79 g/mol |
| Exact Mass | 356.07 |
| IUPAC Name | 2-chloroacetic acid;triphenylphosphane |
| SMILES | O=C(O)CCl.c1ccc(P(c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C18H15P.C2H3ClO2/c1-4-10-16(11-5-1)19(17-12-6-2-7-13-17)18-14-8-3-9-15-18;3-1-2(4)5/h1-15H;1H2,(H,4,5) |
| InChIKey | HUVIYTMXSMOBPC-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 356.79 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze 2-chloroacetic acid;triphenylphosphane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-chloroacetic acid;triphenylphosphane?
The IUPAC name of 2-chloroacetic acid;triphenylphosphane (CID 158594327) is 2-chloroacetic acid;triphenylphosphane.
What is the SMILES notation for 2-chloroacetic acid;triphenylphosphane?
The canonical SMILES for 2-chloroacetic acid;triphenylphosphane is O=C(O)CCl.c1ccc(P(c2ccccc2)c2ccccc2)cc1.
What is the InChIKey of 2-chloroacetic acid;triphenylphosphane?
The InChIKey is HUVIYTMXSMOBPC-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H15P.C2H3ClO2/c1-4-10-16(11-5-1)19(17-12-6-2-7-13-17)18-14-8-3-9-15-18;3-1-2(4)5/h1-15H;1H2,(H,4,5).
What are the key properties of 2-chloroacetic acid;triphenylphosphane?
2-chloroacetic acid;triphenylphosphane has a molecular weight of 356.79 g/mol, XLogP of 3.75, 4 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-chloroacetic acid;triphenylphosphane is sourced from PubChem (CID 158594327), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).