C25H28O5Sn — CID 22450631
2-[2-(2-methoxyethoxy)ethoxy]acetate;triphenylstannanylium (PubChem CID 22450631) has the molecular formula C25H28O5Sn and a molecular weight of 527.21 g/mol. Its IUPAC name is 2-[2-(2-methoxyethoxy)ethoxy]acetate;triphenylstannanylium.
| Compound Name | 2-[2-(2-methoxyethoxy)ethoxy]acetate;triphenylstannanylium |
|---|---|
| PubChem CID | 22450631 |
| Molecular Formula | C25H28O5Sn |
| Molecular Weight | 527.21 g/mol |
| Exact Mass | 528.10 |
| IUPAC Name | 2-[2-(2-methoxyethoxy)ethoxy]acetate;triphenylstannanylium |
| SMILES | COCCOCCOCC(=O)[O-].c1ccc([Sn+](c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C7H14O5.3C6H5.Sn/c1-10-2-3-11-4-5-12-6-7(8)9;3*1-2-4-6-5-3-1;/h2-6H2,1H3,(H,8,9);3*1-5H;/q;;;;+1/p-1 |
| InChIKey | WBERKXQQZQURFA-UHFFFAOYSA-M |
| XLogP | 0.62 |
| TPSA | 67.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.21 |
| LogP ≤ 5 | 0.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|