C7H14O5Zn — CID 87575071
2-[2-(2-methoxyethoxy)ethoxy]acetic acid;zinc (PubChem CID 87575071) has the molecular formula C7H14O5Zn and a molecular weight of 243.57 g/mol. Its IUPAC name is 2-[2-(2-methoxyethoxy)ethoxy]acetic acid;zinc.
| Compound Name | 2-[2-(2-methoxyethoxy)ethoxy]acetic acid;zinc |
|---|---|
| PubChem CID | 87575071 |
| Molecular Formula | C7H14O5Zn |
| Molecular Weight | 243.57 g/mol |
| Exact Mass | 242.01 |
| IUPAC Name | 2-[2-(2-methoxyethoxy)ethoxy]acetic acid;zinc |
| SMILES | COCCOCCOCC(=O)O.[Zn] |
| InChI | InChI=1S/C7H14O5.Zn/c1-10-2-3-11-4-5-12-6-7(8)9;/h2-6H2,1H3,(H,8,9); |
| InChIKey | UNHXRYITRAFRGM-UHFFFAOYSA-N |
| XLogP | -0.25 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.57 |
| LogP ≤ 5 | -0.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|