C9H18O5 — CID 14893271
1,3-bis(2-methoxyethoxy)propan-2-one (PubChem CID 14893271) has the molecular formula C9H18O5 and a molecular weight of 206.24 g/mol. Its IUPAC name is 1,3-bis(2-methoxyethoxy)propan-2-one.
| Compound Name | 1,3-bis(2-methoxyethoxy)propan-2-one |
|---|---|
| PubChem CID | 14893271 |
| Molecular Formula | C9H18O5 |
| Molecular Weight | 206.24 g/mol |
| Exact Mass | 206.12 |
| IUPAC Name | 1,3-bis(2-methoxyethoxy)propan-2-one |
| SMILES | COCCOCC(=O)COCCOC |
| InChI | InChI=1S/C9H18O5/c1-11-3-5-13-7-9(10)8-14-6-4-12-2/h3-8H2,1-2H3 |
| InChIKey | DUYKZVRKTLLVNE-UHFFFAOYSA-N |
| XLogP | -0.12 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.24 |
| LogP ≤ 5 | -0.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|