C9H18O5S — CID 88598510
2-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]ethanethioic S-acid (PubChem CID 88598510) has the molecular formula C9H18O5S and a molecular weight of 238.30 g/mol. Its IUPAC name is 2-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]ethanethioic S-acid.
| Compound Name | 2-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]ethanethioic S-acid |
|---|---|
| PubChem CID | 88598510 |
| Molecular Formula | C9H18O5S |
| Molecular Weight | 238.30 g/mol |
| Exact Mass | 238.09 |
| IUPAC Name | 2-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]ethanethioic S-acid |
| SMILES | COCCOCCOCCOCC(=O)S |
| InChI | InChI=1S/C9H18O5S/c1-11-2-3-12-4-5-13-6-7-14-8-9(10)15/h2-8H2,1H3,(H,10,15) |
| InChIKey | CCFPWWWFWSYEAJ-UHFFFAOYSA-N |
| XLogP | 0.14 |
| TPSA | 53.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.30 |
| LogP ≤ 5 | 0.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|