C7H15NO5 — CID 129081938
N-hydroxy-2-[2-(2-methoxyethoxy)ethoxy]acetamide (PubChem CID 129081938) has the molecular formula C7H15NO5 and a molecular weight of 193.20 g/mol. Its IUPAC name is N-hydroxy-2-[2-(2-methoxyethoxy)ethoxy]acetamide.
| Compound Name | N-hydroxy-2-[2-(2-methoxyethoxy)ethoxy]acetamide |
|---|---|
| PubChem CID | 129081938 |
| Molecular Formula | C7H15NO5 |
| Molecular Weight | 193.20 g/mol |
| Exact Mass | 193.10 |
| IUPAC Name | N-hydroxy-2-[2-(2-methoxyethoxy)ethoxy]acetamide |
| SMILES | COCCOCCOCC(=O)NO |
| InChI | InChI=1S/C7H15NO5/c1-11-2-3-12-4-5-13-6-7(9)8-10/h10H,2-6H2,1H3,(H,8,9) |
| InChIKey | VICINEBZIUFKOV-UHFFFAOYSA-N |
| XLogP | -0.83 |
| TPSA | 77.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.20 |
| LogP ≤ 5 | -0.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|