C8H15NO5 — CID 43431221
methyl 2-[[2-(2-methoxyethoxy)acetyl]amino]acetate (PubChem CID 43431221) has the molecular formula C8H15NO5 and a molecular weight of 205.21 g/mol. Its IUPAC name is methyl 2-[[2-(2-methoxyethoxy)acetyl]amino]acetate.
| Compound Name | methyl 2-[[2-(2-methoxyethoxy)acetyl]amino]acetate |
|---|---|
| PubChem CID | 43431221 |
| Molecular Formula | C8H15NO5 |
| Molecular Weight | 205.21 g/mol |
| Exact Mass | 205.10 |
| IUPAC Name | methyl 2-[[2-(2-methoxyethoxy)acetyl]amino]acetate |
| SMILES | COCCOCC(=O)NCC(=O)OC |
| InChI | InChI=1S/C8H15NO5/c1-12-3-4-14-6-7(10)9-5-8(11)13-2/h3-6H2,1-2H3,(H,9,10) |
| InChIKey | NANXXKMEVIEVRB-UHFFFAOYSA-N |
| XLogP | -1.06 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.21 |
| LogP ≤ 5 | -1.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|