C5H12N2O3 — CID 43237114
2-(2-methoxyethoxy)acetohydrazide (PubChem CID 43237114) has the molecular formula C5H12N2O3 and a molecular weight of 148.16 g/mol. Its IUPAC name is 2-(2-methoxyethoxy)acetohydrazide.
| Compound Name | 2-(2-methoxyethoxy)acetohydrazide |
|---|---|
| PubChem CID | 43237114 |
| Molecular Formula | C5H12N2O3 |
| Molecular Weight | 148.16 g/mol |
| Exact Mass | 148.08 |
| IUPAC Name | 2-(2-methoxyethoxy)acetohydrazide |
| SMILES | COCCOCC(=O)NN |
| InChI | InChI=1S/C5H12N2O3/c1-9-2-3-10-4-5(8)7-6/h2-4,6H2,1H3,(H,7,8) |
| InChIKey | HLLFHVHRBLXBHU-UHFFFAOYSA-N |
| XLogP | -1.36 |
| TPSA | 73.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 148.16 |
| LogP ≤ 5 | -1.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|