C7H15NO3 — CID 60651065
N-ethyl-2-(2-methoxyethoxy)acetamide (PubChem CID 60651065) has the molecular formula C7H15NO3 and a molecular weight of 161.20 g/mol. Its IUPAC name is N-ethyl-2-(2-methoxyethoxy)acetamide.
| Compound Name | N-ethyl-2-(2-methoxyethoxy)acetamide |
|---|---|
| PubChem CID | 60651065 |
| Molecular Formula | C7H15NO3 |
| Molecular Weight | 161.20 g/mol |
| Exact Mass | 161.11 |
| IUPAC Name | N-ethyl-2-(2-methoxyethoxy)acetamide |
| SMILES | CCNC(=O)COCCOC |
| InChI | InChI=1S/C7H15NO3/c1-3-8-7(9)6-11-5-4-10-2/h3-6H2,1-2H3,(H,8,9) |
| InChIKey | GDFLOQQOIFWCCF-UHFFFAOYSA-N |
| XLogP | -0.21 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 161.20 |
| LogP ≤ 5 | -0.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|