C12H27NO5 — CID 167443378
ethane;N-ethyl-2-[2-[2-(2-hydroxyethoxy)ethoxy]ethoxy]acetamide (PubChem CID 167443378) has the molecular formula C12H27NO5 and a molecular weight of 265.35 g/mol. Its IUPAC name is ethane;N-ethyl-2-[2-[2-(2-hydroxyethoxy)ethoxy]ethoxy]acetamide.
| Compound Name | ethane;N-ethyl-2-[2-[2-(2-hydroxyethoxy)ethoxy]ethoxy]acetamide |
|---|---|
| PubChem CID | 167443378 |
| Molecular Formula | C12H27NO5 |
| Molecular Weight | 265.35 g/mol |
| Exact Mass | 265.19 |
| IUPAC Name | ethane;N-ethyl-2-[2-[2-(2-hydroxyethoxy)ethoxy]ethoxy]acetamide |
| SMILES | CC.CCNC(=O)COCCOCCOCCO |
| InChI | InChI=1S/C10H21NO5.C2H6/c1-2-11-10(13)9-16-8-7-15-6-5-14-4-3-12;1-2/h12H,2-9H2,1H3,(H,11,13);1-2H3 |
| InChIKey | MEVLHAGVSNDQDT-UHFFFAOYSA-N |
| XLogP | 0.19 |
| TPSA | 77.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.35 |
| LogP ≤ 5 | 0.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|