C14H29NO6 — CID 146605936
N-tert-butyl-2-[2-[2-[2-(2-hydroxyethoxy)ethoxy]ethoxy]ethoxy]acetamide (PubChem CID 146605936) has the molecular formula C14H29NO6 and a molecular weight of 307.39 g/mol. Its IUPAC name is N-tert-butyl-2-[2-[2-[2-(2-hydroxyethoxy)ethoxy]ethoxy]ethoxy]acetamide.
| Compound Name | N-tert-butyl-2-[2-[2-[2-(2-hydroxyethoxy)ethoxy]ethoxy]ethoxy]acetamide |
|---|---|
| PubChem CID | 146605936 |
| Molecular Formula | C14H29NO6 |
| Molecular Weight | 307.39 g/mol |
| Exact Mass | 307.20 |
| IUPAC Name | N-tert-butyl-2-[2-[2-[2-(2-hydroxyethoxy)ethoxy]ethoxy]ethoxy]acetamide |
| SMILES | CC(C)(C)NC(=O)COCCOCCOCCOCCO |
| InChI | InChI=1S/C14H29NO6/c1-14(2,3)15-13(17)12-21-11-10-20-9-8-19-7-6-18-5-4-16/h16H,4-12H2,1-3H3,(H,15,17) |
| InChIKey | XUPHJIXJOPBXMV-UHFFFAOYSA-N |
| XLogP | -0.04 |
| TPSA | 86.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.39 |
| LogP ≤ 5 | -0.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|