C13H27NO6 — CID 129320050
2-[2-[2-(2-hydroxyethoxy)ethoxy]ethoxy]ethyl N-tert-butylcarbamate (PubChem CID 129320050) has the molecular formula C13H27NO6 and a molecular weight of 293.36 g/mol. Its IUPAC name is 2-[2-[2-(2-hydroxyethoxy)ethoxy]ethoxy]ethyl N-tert-butylcarbamate.
| Compound Name | 2-[2-[2-(2-hydroxyethoxy)ethoxy]ethoxy]ethyl N-tert-butylcarbamate |
|---|---|
| PubChem CID | 129320050 |
| Molecular Formula | C13H27NO6 |
| Molecular Weight | 293.36 g/mol |
| Exact Mass | 293.18 |
| IUPAC Name | 2-[2-[2-(2-hydroxyethoxy)ethoxy]ethoxy]ethyl N-tert-butylcarbamate |
| SMILES | CC(C)(C)NC(=O)OCCOCCOCCOCCO |
| InChI | InChI=1S/C13H27NO6/c1-13(2,3)14-12(16)20-11-10-19-9-8-18-7-6-17-5-4-15/h15H,4-11H2,1-3H3,(H,14,16) |
| InChIKey | BZTJGKNVYBLXCX-UHFFFAOYSA-N |
| XLogP | 0.55 |
| TPSA | 86.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.36 |
| LogP ≤ 5 | 0.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|