C12H24N2O4 — CID 176596941
2-(tert-butylcarbamoyloxy)ethyl N-tert-butylcarbamate (PubChem CID 176596941) has the molecular formula C12H24N2O4 and a molecular weight of 260.33 g/mol. Its IUPAC name is 2-(tert-butylcarbamoyloxy)ethyl N-tert-butylcarbamate.
| Compound Name | 2-(tert-butylcarbamoyloxy)ethyl N-tert-butylcarbamate |
|---|---|
| PubChem CID | 176596941 |
| Molecular Formula | C12H24N2O4 |
| Molecular Weight | 260.33 g/mol |
| Exact Mass | 260.17 |
| IUPAC Name | 2-(tert-butylcarbamoyloxy)ethyl N-tert-butylcarbamate |
| SMILES | CC(C)(C)NC(=O)OCCOC(=O)NC(C)(C)C |
| InChI | InChI=1S/C12H24N2O4/c1-11(2,3)13-9(15)17-7-8-18-10(16)14-12(4,5)6/h7-8H2,1-6H3,(H,13,15)(H,14,16) |
| InChIKey | ZKHLVIQAHHGZDL-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.33 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|