C12H25N3O4 — CID 91281595
2-[methyl-[2-(methylcarbamoyloxy)ethyl]amino]ethyl N-tert-butylcarbamate (PubChem CID 91281595) has the molecular formula C12H25N3O4 and a molecular weight of 275.35 g/mol. Its IUPAC name is 2-[methyl-[2-(methylcarbamoyloxy)ethyl]amino]ethyl N-tert-butylcarbamate.
| Compound Name | 2-[methyl-[2-(methylcarbamoyloxy)ethyl]amino]ethyl N-tert-butylcarbamate |
|---|---|
| PubChem CID | 91281595 |
| Molecular Formula | C12H25N3O4 |
| Molecular Weight | 275.35 g/mol |
| Exact Mass | 275.18 |
| IUPAC Name | 2-[methyl-[2-(methylcarbamoyloxy)ethyl]amino]ethyl N-tert-butylcarbamate |
| SMILES | CNC(=O)OCCN(C)CCOC(=O)NC(C)(C)C |
| InChI | InChI=1S/C12H25N3O4/c1-12(2,3)14-11(17)19-9-7-15(5)6-8-18-10(16)13-4/h6-9H2,1-5H3,(H,13,16)(H,14,17) |
| InChIKey | OTCLLYSOHKKQHI-UHFFFAOYSA-N |
| XLogP | 0.80 |
| TPSA | 79.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.35 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |