C10H18N2O3 — CID 143586644
2-(prop-2-enoylamino)ethyl N-tert-butylcarbamate (PubChem CID 143586644) has the molecular formula C10H18N2O3 and a molecular weight of 214.26 g/mol. Its IUPAC name is 2-(prop-2-enoylamino)ethyl N-tert-butylcarbamate.
| Compound Name | 2-(prop-2-enoylamino)ethyl N-tert-butylcarbamate |
|---|---|
| PubChem CID | 143586644 |
| Molecular Formula | C10H18N2O3 |
| Molecular Weight | 214.26 g/mol |
| Exact Mass | 214.13 |
| IUPAC Name | 2-(prop-2-enoylamino)ethyl N-tert-butylcarbamate |
| SMILES | C=CC(=O)NCCOC(=O)NC(C)(C)C |
| InChI | InChI=1S/C10H18N2O3/c1-5-8(13)11-6-7-15-9(14)12-10(2,3)4/h5H,1,6-7H2,2-4H3,(H,11,13)(H,12,14) |
| InChIKey | VDBJAMJRCHOJAJ-UHFFFAOYSA-N |
| XLogP | 0.81 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.26 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|