About N-(3-aminopropyl)prop-2-enamide;chloromethane
N-(3-aminopropyl)prop-2-enamide;chloromethane (PubChem CID 126509380) has the molecular formula C7H15ClN2O
and a molecular weight of 178.66 g/mol. Its IUPAC name is N-(3-aminopropyl)prop-2-enamide;chloromethane.
Molecular Properties
| Compound Name | N-(3-aminopropyl)prop-2-enamide;chloromethane |
| PubChem CID | 126509380 |
| Molecular Formula | C7H15ClN2O |
| Molecular Weight | 178.66 g/mol |
| Exact Mass | 178.09 |
| IUPAC Name | N-(3-aminopropyl)prop-2-enamide;chloromethane |
| SMILES | C=CC(=O)NCCCN.CCl |
| InChI | InChI=1S/C6H12N2O.CH3Cl/c1-2-6(9)8-5-3-4-7;1-2/h2H,1,3-5,7H2,(H,8,9);1H3 |
| InChIKey | HXZANQHHDBBJFY-UHFFFAOYSA-N |
| XLogP | 0.49 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 178.66 |
| LogP ≤ 5 | 0.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze N-(3-aminopropyl)prop-2-enamide;chloromethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(3-aminopropyl)prop-2-enamide;chloromethane?
The IUPAC name of N-(3-aminopropyl)prop-2-enamide;chloromethane (CID 126509380) is N-(3-aminopropyl)prop-2-enamide;chloromethane.
What is the SMILES notation for N-(3-aminopropyl)prop-2-enamide;chloromethane?
The canonical SMILES for N-(3-aminopropyl)prop-2-enamide;chloromethane is C=CC(=O)NCCCN.CCl.
What is the InChIKey of N-(3-aminopropyl)prop-2-enamide;chloromethane?
The InChIKey is HXZANQHHDBBJFY-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H12N2O.CH3Cl/c1-2-6(9)8-5-3-4-7;1-2/h2H,1,3-5,7H2,(H,8,9);1H3.
What are the key properties of N-(3-aminopropyl)prop-2-enamide;chloromethane?
N-(3-aminopropyl)prop-2-enamide;chloromethane has a molecular weight of 178.66 g/mol, XLogP of 0.49, 4 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-(3-aminopropyl)prop-2-enamide;chloromethane is sourced from PubChem (CID 126509380), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).