C9H20N2O4S — CID 175014002
N-(3-aminopropyl)prop-2-enamide;propane-1-sulfonic acid (PubChem CID 175014002) has the molecular formula C9H20N2O4S and a molecular weight of 252.34 g/mol. Its IUPAC name is N-(3-aminopropyl)prop-2-enamide;propane-1-sulfonic acid.
| Compound Name | N-(3-aminopropyl)prop-2-enamide;propane-1-sulfonic acid |
|---|---|
| PubChem CID | 175014002 |
| Molecular Formula | C9H20N2O4S |
| Molecular Weight | 252.34 g/mol |
| Exact Mass | 252.11 |
| IUPAC Name | N-(3-aminopropyl)prop-2-enamide;propane-1-sulfonic acid |
| SMILES | C=CC(=O)NCCCN.CCCS(=O)(=O)O |
| InChI | InChI=1S/C6H12N2O.C3H8O3S/c1-2-6(9)8-5-3-4-7;1-2-3-7(4,5)6/h2H,1,3-5,7H2,(H,8,9);2-3H2,1H3,(H,4,5,6) |
| InChIKey | KPQAQALZXDWKRN-UHFFFAOYSA-N |
| XLogP | -0.08 |
| TPSA | 109.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.34 |
| LogP ≤ 5 | -0.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|