C15H31N2O4S+ — CID 134346586
3-(prop-2-enoylamino)propyl-dipropyl-(3-sulfopropyl)azanium (PubChem CID 134346586) has the molecular formula C15H31N2O4S+ and a molecular weight of 335.49 g/mol. Its IUPAC name is 3-(prop-2-enoylamino)propyl-dipropyl-(3-sulfopropyl)azanium.
| Compound Name | 3-(prop-2-enoylamino)propyl-dipropyl-(3-sulfopropyl)azanium |
|---|---|
| PubChem CID | 134346586 |
| Molecular Formula | C15H31N2O4S+ |
| Molecular Weight | 335.49 g/mol |
| Exact Mass | 335.20 |
| IUPAC Name | 3-(prop-2-enoylamino)propyl-dipropyl-(3-sulfopropyl)azanium |
| SMILES | C=CC(=O)NCCC[N+](CCC)(CCC)CCCS(=O)(=O)O |
| InChI | InChI=1S/C15H30N2O4S/c1-4-10-17(11-5-2,13-8-14-22(19,20)21)12-7-9-16-15(18)6-3/h6H,3-5,7-14H2,1-2H3,(H-,16,18,19,20,21)/p+1 |
| InChIKey | DDBSJDDKPCLYOF-UHFFFAOYSA-O |
| XLogP | 1.59 |
| TPSA | 83.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.49 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|