C11H23N2O5S+ — CID 88775284
(2-hydroxy-3-sulfopropyl)-dimethyl-[3-(prop-2-enoylamino)propyl]azanium (PubChem CID 88775284) has the molecular formula C11H23N2O5S+ and a molecular weight of 295.38 g/mol. Its IUPAC name is (2-hydroxy-3-sulfopropyl)-dimethyl-[3-(prop-2-enoylamino)propyl]azanium.
| Compound Name | (2-hydroxy-3-sulfopropyl)-dimethyl-[3-(prop-2-enoylamino)propyl]azanium |
|---|---|
| PubChem CID | 88775284 |
| Molecular Formula | C11H23N2O5S+ |
| Molecular Weight | 295.38 g/mol |
| Exact Mass | 295.13 |
| IUPAC Name | (2-hydroxy-3-sulfopropyl)-dimethyl-[3-(prop-2-enoylamino)propyl]azanium |
| SMILES | C=CC(=O)NCCC[N+](C)(C)CC(O)CS(=O)(=O)O |
| InChI | InChI=1S/C11H22N2O5S/c1-4-11(15)12-6-5-7-13(2,3)8-10(14)9-19(16,17)18/h4,10,14H,1,5-9H2,2-3H3,(H-,12,15,16,17,18)/p+1 |
| InChIKey | RNXIEHAYHIOERX-UHFFFAOYSA-O |
| XLogP | -1.00 |
| TPSA | 103.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.38 |
| LogP ≤ 5 | -1.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|