C19H39N2O5S+ — CID 123614779
3-(dec-9-enoylamino)propyl-ethyl-(2-hydroxy-3-sulfopropyl)-methylazanium (PubChem CID 123614779) has the molecular formula C19H39N2O5S+ and a molecular weight of 407.60 g/mol. Its IUPAC name is 3-(dec-9-enoylamino)propyl-ethyl-(2-hydroxy-3-sulfopropyl)-methylazanium.
| Compound Name | 3-(dec-9-enoylamino)propyl-ethyl-(2-hydroxy-3-sulfopropyl)-methylazanium |
|---|---|
| PubChem CID | 123614779 |
| Molecular Formula | C19H39N2O5S+ |
| Molecular Weight | 407.60 g/mol |
| Exact Mass | 407.26 |
| IUPAC Name | 3-(dec-9-enoylamino)propyl-ethyl-(2-hydroxy-3-sulfopropyl)-methylazanium |
| SMILES | C=CCCCCCCCC(=O)NCCC[N+](C)(CC)CC(O)CS(=O)(=O)O |
| InChI | InChI=1S/C19H38N2O5S/c1-4-6-7-8-9-10-11-13-19(23)20-14-12-15-21(3,5-2)16-18(22)17-27(24,25)26/h4,18,22H,1,5-17H2,2-3H3,(H-,20,23,24,25,26)/p+1 |
| InChIKey | TVOXHHYVIIIZDE-UHFFFAOYSA-O |
| XLogP | 2.12 |
| TPSA | 103.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.60 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|