C47H93N3O6S — CID 139595653
ethyl-methyl-bis[3-[[(Z)-octadec-9-enoyl]amino]propyl]azanium;ethyl sulfate (PubChem CID 139595653) has the molecular formula C47H93N3O6S and a molecular weight of 828.34 g/mol. Its IUPAC name is ethyl-methyl-bis[3-[[(Z)-octadec-9-enoyl]amino]propyl]azanium;ethyl sulfate.
| Compound Name | ethyl-methyl-bis[3-[[(Z)-octadec-9-enoyl]amino]propyl]azanium;ethyl sulfate |
|---|---|
| PubChem CID | 139595653 |
| Molecular Formula | C47H93N3O6S |
| Molecular Weight | 828.34 g/mol |
| Exact Mass | 827.68 |
| IUPAC Name | ethyl-methyl-bis[3-[[(Z)-octadec-9-enoyl]amino]propyl]azanium;ethyl sulfate |
| SMILES | CCCCCCCC/C=C\CCCCCCCC(=O)NCCC[N+](C)(CC)CCCNC(=O)CCCCCCC/C=C\CCCCCCCC.CCOS(=O)(=O)[O-] |
| InChI | InChI=1S/C45H87N3O2.C2H6O4S/c1-5-8-10-12-14-16-18-20-22-24-26-28-30-32-34-38-44(49)46-40-36-42-48(4,7-3)43-37-41-47-45(50)39-35-33-31-29-27-25-23-21-19-17-15-13-11-9-6-2;1-2-6-7(3,4)5/h20-23H,5-19,24-43H2,1-4H3,(H-,46,47,49,50);2H2,1H3,(H,3,4,5)/b22-20-,23-21-; |
| InChIKey | JVGDJSIDYJEIRF-LQDDAWAPSA-N |
| XLogP | 12.02 |
| TPSA | 124.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 41 |
| Heavy Atoms | 57 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 828.34 |
| LogP ≤ 5 | 12.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'sulphate', 'substructure': 'N/A'} |
|---|