C27H59N3O5S — CID 175037916
ethanamine;ethyl-dimethyl-[3-[[(Z)-octadec-9-enoyl]amino]propyl]azanium;hydrogen sulfate (PubChem CID 175037916) has the molecular formula C27H59N3O5S and a molecular weight of 537.85 g/mol. Its IUPAC name is ethanamine;ethyl-dimethyl-[3-[[(Z)-octadec-9-enoyl]amino]propyl]azanium;hydrogen sulfate.
| Compound Name | ethanamine;ethyl-dimethyl-[3-[[(Z)-octadec-9-enoyl]amino]propyl]azanium;hydrogen sulfate |
|---|---|
| PubChem CID | 175037916 |
| Molecular Formula | C27H59N3O5S |
| Molecular Weight | 537.85 g/mol |
| Exact Mass | 537.42 |
| IUPAC Name | ethanamine;ethyl-dimethyl-[3-[[(Z)-octadec-9-enoyl]amino]propyl]azanium;hydrogen sulfate |
| SMILES | CCCCCCCC/C=C\CCCCCCCC(=O)NCCC[N+](C)(C)CC.CCN.O=S(=O)([O-])O |
| InChI | InChI=1S/C25H50N2O.C2H7N.H2O4S/c1-5-7-8-9-10-11-12-13-14-15-16-17-18-19-20-22-25(28)26-23-21-24-27(3,4)6-2;1-2-3;1-5(2,3)4/h13-14H,5-12,15-24H2,1-4H3;2-3H2,1H3;(H2,1,2,3,4)/b14-13-;; |
| InChIKey | ZQVBMRJRPJZFQH-HLBFIJABSA-N |
| XLogP | 5.60 |
| TPSA | 132.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.85 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'sulphate', 'substructure': 'N/A'} |
|---|