C25H51ClN2O2 — CID 173166398
2-hydroxyethyl-dimethyl-[3-(octadec-9-enoylamino)propyl]azanium chloride (PubChem CID 173166398) has the molecular formula C25H51ClN2O2 and a molecular weight of 447.15 g/mol. Its IUPAC name is 2-hydroxyethyl-dimethyl-[3-(octadec-9-enoylamino)propyl]azanium chloride.
| Compound Name | 2-hydroxyethyl-dimethyl-[3-(octadec-9-enoylamino)propyl]azanium chloride |
|---|---|
| PubChem CID | 173166398 |
| Molecular Formula | C25H51ClN2O2 |
| Molecular Weight | 447.15 g/mol |
| Exact Mass | 446.36 |
| IUPAC Name | 2-hydroxyethyl-dimethyl-[3-(octadec-9-enoylamino)propyl]azanium chloride |
| SMILES | CCCCCCCCC=CCCCCCCCC(=O)NCCC[N+](C)(C)CCO.[Cl-] |
| InChI | InChI=1S/C25H50N2O2.ClH/c1-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-20-25(29)26-21-19-22-27(2,3)23-24-28;/h11-12,28H,4-10,13-24H2,1-3H3;1H |
| InChIKey | SUUMRJDFAUYAEZ-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.15 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|