C43H83ClN2O3 — CID 173166751
dimethyl-[3-(octadec-9-enoylamino)propyl]-(2-octadec-9-enoyloxyethyl)azanium chloride (PubChem CID 173166751) has the molecular formula C43H83ClN2O3 and a molecular weight of 711.60 g/mol. Its IUPAC name is dimethyl-[3-(octadec-9-enoylamino)propyl]-(2-octadec-9-enoyloxyethyl)azanium chloride.
| Compound Name | dimethyl-[3-(octadec-9-enoylamino)propyl]-(2-octadec-9-enoyloxyethyl)azanium chloride |
|---|---|
| PubChem CID | 173166751 |
| Molecular Formula | C43H83ClN2O3 |
| Molecular Weight | 711.60 g/mol |
| Exact Mass | 710.61 |
| IUPAC Name | dimethyl-[3-(octadec-9-enoylamino)propyl]-(2-octadec-9-enoyloxyethyl)azanium chloride |
| SMILES | CCCCCCCCC=CCCCCCCCC(=O)NCCC[N+](C)(C)CCOC(=O)CCCCCCCC=CCCCCCCCC.[Cl-] |
| InChI | InChI=1S/C43H82N2O3.ClH/c1-5-7-9-11-13-15-17-19-21-23-25-27-29-31-33-36-42(46)44-38-35-39-45(3,4)40-41-48-43(47)37-34-32-30-28-26-24-22-20-18-16-14-12-10-8-6-2;/h19-22H,5-18,23-41H2,1-4H3;1H |
| InChIKey | VUZOCZGYOPHWNI-UHFFFAOYSA-N |
| XLogP | 9.19 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 37 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 711.60 |
| LogP ≤ 5 | 9.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|