C25H47N2O3+ — CID 53340482
carboxymethyl-dimethyl-[3-[[(9Z,12Z)-octadeca-9,12-dienoyl]amino]propyl]azanium (PubChem CID 53340482) has the molecular formula C25H47N2O3+ and a molecular weight of 423.66 g/mol. Its IUPAC name is carboxymethyl-dimethyl-[3-[[(9Z,12Z)-octadeca-9,12-dienoyl]amino]propyl]azanium.
| Compound Name | carboxymethyl-dimethyl-[3-[[(9Z,12Z)-octadeca-9,12-dienoyl]amino]propyl]azanium |
|---|---|
| PubChem CID | 53340482 |
| Molecular Formula | C25H47N2O3+ |
| Molecular Weight | 423.66 g/mol |
| Exact Mass | 423.36 |
| IUPAC Name | carboxymethyl-dimethyl-[3-[[(9Z,12Z)-octadeca-9,12-dienoyl]amino]propyl]azanium |
| SMILES | CCCCC/C=C\C/C=C\CCCCCCCC(=O)NCCC[N+](C)(C)CC(=O)O |
| InChI | InChI=1S/C25H46N2O3/c1-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-20-24(28)26-21-19-22-27(2,3)23-25(29)30/h8-9,11-12H,4-7,10,13-23H2,1-3H3,(H-,26,28,29,30)/p+1/b9-8-,12-11- |
| InChIKey | LVSBNLWNNVOIGX-MURFETPASA-O |
| XLogP | 5.47 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.66 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|