C31H64N4O3+2 — CID 160759465
3-(dec-9-enoylamino)propyl-hydroxy-dimethylazanium;3-(dec-9-enoylamino)propyl-trimethylazanium (PubChem CID 160759465) has the molecular formula C31H64N4O3+2 and a molecular weight of 540.88 g/mol. Its IUPAC name is 3-(dec-9-enoylamino)propyl-hydroxy-dimethylazanium;3-(dec-9-enoylamino)propyl-trimethylazanium.
| Compound Name | 3-(dec-9-enoylamino)propyl-hydroxy-dimethylazanium;3-(dec-9-enoylamino)propyl-trimethylazanium |
|---|---|
| PubChem CID | 160759465 |
| Molecular Formula | C31H64N4O3+2 |
| Molecular Weight | 540.88 g/mol |
| Exact Mass | 540.50 |
| IUPAC Name | 3-(dec-9-enoylamino)propyl-hydroxy-dimethylazanium;3-(dec-9-enoylamino)propyl-trimethylazanium |
| SMILES | C=CCCCCCCCC(=O)NCCC[N+](C)(C)C.C=CCCCCCCCC(=O)NCCC[N+](C)(C)O |
| InChI | InChI=1S/C16H32N2O.C15H30N2O2/c1-5-6-7-8-9-10-11-13-16(19)17-14-12-15-18(2,3)4;1-4-5-6-7-8-9-10-12-15(18)16-13-11-14-17(2,3)19/h5H,1,6-15H2,2-4H3;4,19H,1,5-14H2,2-3H3/p+2 |
| InChIKey | LPKZVHDCCIOPND-UHFFFAOYSA-P |
| XLogP | 5.99 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 24 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.88 |
| LogP ≤ 5 | 5.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|