C29H62N4O3+2 — CID 163969534
hydroxy-[3-[[(E)-1-hydroxy-18-oxo-18-[3-(trimethylazaniumyl)propylamino]octadec-9-enyl]amino]propyl]-dimethylazanium (PubChem CID 163969534) has the molecular formula C29H62N4O3+2 and a molecular weight of 514.84 g/mol. Its IUPAC name is hydroxy-[3-[[(E)-1-hydroxy-18-oxo-18-[3-(trimethylazaniumyl)propylamino]octadec-9-enyl]amino]propyl]-dimethylazanium.
| Compound Name | hydroxy-[3-[[(E)-1-hydroxy-18-oxo-18-[3-(trimethylazaniumyl)propylamino]octadec-9-enyl]amino]propyl]-dimethylazanium |
|---|---|
| PubChem CID | 163969534 |
| Molecular Formula | C29H62N4O3+2 |
| Molecular Weight | 514.84 g/mol |
| Exact Mass | 514.48 |
| IUPAC Name | hydroxy-[3-[[(E)-1-hydroxy-18-oxo-18-[3-(trimethylazaniumyl)propylamino]octadec-9-enyl]amino]propyl]-dimethylazanium |
| SMILES | C[N+](C)(C)CCCNC(=O)CCCCCCC/C=C/CCCCCCCC(O)NCCC[N+](C)(C)O |
| InChI | InChI=1S/C29H61N4O3/c1-32(2,3)26-20-24-30-28(34)22-18-16-14-12-10-8-6-7-9-11-13-15-17-19-23-29(35)31-25-21-27-33(4,5)36/h6-7,29,31,35-36H,8-27H2,1-5H3/q+1/p+1/b7-6+ |
| InChIKey | KTLWZEDHBQMKAU-VOTSOKGWSA-O |
| XLogP | 4.98 |
| TPSA | 81.59 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 25 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.84 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|