C24H49N2O2+ — CID 91586213
3-[[(12R)-12-hydroxyoctadec-9-enoyl]amino]propyl-trimethylazanium (PubChem CID 91586213) has the molecular formula C24H49N2O2+ and a molecular weight of 397.67 g/mol. Its IUPAC name is 3-[[(12R)-12-hydroxyoctadec-9-enoyl]amino]propyl-trimethylazanium.
| Compound Name | 3-[[(12R)-12-hydroxyoctadec-9-enoyl]amino]propyl-trimethylazanium |
|---|---|
| PubChem CID | 91586213 |
| Molecular Formula | C24H49N2O2+ |
| Molecular Weight | 397.67 g/mol |
| Exact Mass | 397.38 |
| IUPAC Name | 3-[[(12R)-12-hydroxyoctadec-9-enoyl]amino]propyl-trimethylazanium |
| SMILES | CCCCCC[C@@H](O)CC=CCCCCCCCC(=O)NCCC[N+](C)(C)C |
| InChI | InChI=1S/C24H48N2O2/c1-5-6-7-14-18-23(27)19-15-12-10-8-9-11-13-16-20-24(28)25-21-17-22-26(2,3)4/h12,15,23,27H,5-11,13-14,16-22H2,1-4H3/p+1/t23-/m1/s1 |
| InChIKey | NYGFQRKIKKRNLC-HSZRJFAPSA-O |
| XLogP | 5.21 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.67 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|