C32H57N2O2+ — CID 88813231
benzyl-diethyl-[3-[[(Z)-12-hydroxyoctadec-9-enoyl]amino]propyl]azanium (PubChem CID 88813231) has the molecular formula C32H57N2O2+ and a molecular weight of 501.82 g/mol. Its IUPAC name is benzyl-diethyl-[3-[[(Z)-12-hydroxyoctadec-9-enoyl]amino]propyl]azanium.
| Compound Name | benzyl-diethyl-[3-[[(Z)-12-hydroxyoctadec-9-enoyl]amino]propyl]azanium |
|---|---|
| PubChem CID | 88813231 |
| Molecular Formula | C32H57N2O2+ |
| Molecular Weight | 501.82 g/mol |
| Exact Mass | 501.44 |
| IUPAC Name | benzyl-diethyl-[3-[[(Z)-12-hydroxyoctadec-9-enoyl]amino]propyl]azanium |
| SMILES | CCCCCCC(O)C/C=C\CCCCCCCC(=O)NCCC[N+](CC)(CC)Cc1ccccc1 |
| InChI | InChI=1S/C32H56N2O2/c1-4-7-8-18-24-31(35)25-19-13-11-9-10-12-14-20-26-32(36)33-27-21-28-34(5-2,6-3)29-30-22-16-15-17-23-30/h13,15-17,19,22-23,31,35H,4-12,14,18,20-21,24-29H2,1-3H3/p+1/b19-13- |
| InChIKey | DHBDBXQNVYUZKT-UYRXBGFRSA-O |
| XLogP | 7.56 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 23 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.82 |
| LogP ≤ 5 | 7.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|