C36H67NO4 — CID 87119921
(Z,12R)-12-hydroxy-N-[(Z,12R)-12-hydroxyoctadec-9-enoyl]octadec-9-enamide (PubChem CID 87119921) has the molecular formula C36H67NO4 and a molecular weight of 577.94 g/mol. Its IUPAC name is (Z,12R)-12-hydroxy-N-[(Z,12R)-12-hydroxyoctadec-9-enoyl]octadec-9-enamide.
| Compound Name | (Z,12R)-12-hydroxy-N-[(Z,12R)-12-hydroxyoctadec-9-enoyl]octadec-9-enamide |
|---|---|
| PubChem CID | 87119921 |
| Molecular Formula | C36H67NO4 |
| Molecular Weight | 577.94 g/mol |
| Exact Mass | 577.51 |
| IUPAC Name | (Z,12R)-12-hydroxy-N-[(Z,12R)-12-hydroxyoctadec-9-enoyl]octadec-9-enamide |
| SMILES | CCCCCC[C@@H](O)C/C=C\CCCCCCCC(=O)NC(=O)CCCCCCC/C=C\C[C@H](O)CCCCCC |
| InChI | InChI=1S/C36H67NO4/c1-3-5-7-21-27-33(38)29-23-17-13-9-11-15-19-25-31-35(40)37-36(41)32-26-20-16-12-10-14-18-24-30-34(39)28-22-8-6-4-2/h17-18,23-24,33-34,38-39H,3-16,19-22,25-32H2,1-2H3,(H,37,40,41)/b23-17-,24-18-/t33-,34-/m1/s1 |
| InChIKey | LVWFDVKKZCWCQV-INAQYUPRSA-N |
| XLogP | 9.65 |
| TPSA | 86.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 30 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 577.94 |
| LogP ≤ 5 | 9.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|